C19H21N5O — CID 24989132
2-[4-(2-butyl-4-oxoquinazolin-3-yl)phenyl]guanidine (PubChem CID 24989132) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-[4-(2-butyl-4-oxoquinazolin-3-yl)phenyl]guanidine.
| Compound Name | 2-[4-(2-butyl-4-oxoquinazolin-3-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 24989132 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-[4-(2-butyl-4-oxoquinazolin-3-yl)phenyl]guanidine |
| SMILES | CCCCc1nc2ccccc2c(=O)n1-c1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C19H21N5O/c1-2-3-8-17-23-16-7-5-4-6-15(16)18(25)24(17)14-11-9-13(10-12-14)22-19(20)21/h4-7,9-12H,2-3,8H2,1H3,(H4,20,21,22) |
| InChIKey | KHGQHQJZSKKKNF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|