C30H27FN4O4 — CID 134476683
5-[3-(4-fluorophenyl)-7-[5-[2-[(methylideneamino)methyl]phenyl]-4,5-dihydro-1,2-oxazol-3-yl]-4-oxoquinazolin-2-yl]pentanoic acid (PubChem CID 134476683) has the molecular formula C30H27FN4O4 and a molecular weight of 526.57 g/mol. Its IUPAC name is 5-[3-(4-fluorophenyl)-7-[5-[2-[(methylideneamino)methyl]phenyl]-4,5-dihydro-1,2-oxazol-3-yl]-4-oxoquinazolin-2-yl]pentanoic acid.
| Compound Name | 5-[3-(4-fluorophenyl)-7-[5-[2-[(methylideneamino)methyl]phenyl]-4,5-dihydro-1,2-oxazol-3-yl]-4-oxoquinazolin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 134476683 |
| Molecular Formula | C30H27FN4O4 |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 5-[3-(4-fluorophenyl)-7-[5-[2-[(methylideneamino)methyl]phenyl]-4,5-dihydro-1,2-oxazol-3-yl]-4-oxoquinazolin-2-yl]pentanoic acid |
| SMILES | C=NCc1ccccc1C1CC(c2ccc3c(=O)n(-c4ccc(F)cc4)c(CCCCC(=O)O)nc3c2)=NO1 |
| InChI | InChI=1S/C30H27FN4O4/c1-32-18-20-6-2-3-7-23(20)27-17-25(34-39-27)19-10-15-24-26(16-19)33-28(8-4-5-9-29(36)37)35(30(24)38)22-13-11-21(31)12-14-22/h2-3,6-7,10-16,27H,1,4-5,8-9,17-18H2,(H,36,37) |
| InChIKey | VJWGCXFVTNXKFQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|