C29H34N8O3 — CID 142506241
2,4-diamino-6-methylpyrimidine-5-carbonitrile;N-hydroxy-6-(4-oxo-3-phenyl-2-propylquinazolin-5-yl)hexanamide (PubChem CID 142506241) has the molecular formula C29H34N8O3 and a molecular weight of 542.64 g/mol. Its IUPAC name is 2,4-diamino-6-methylpyrimidine-5-carbonitrile;N-hydroxy-6-(4-oxo-3-phenyl-2-propylquinazolin-5-yl)hexanamide.
| Compound Name | 2,4-diamino-6-methylpyrimidine-5-carbonitrile;N-hydroxy-6-(4-oxo-3-phenyl-2-propylquinazolin-5-yl)hexanamide |
|---|---|
| PubChem CID | 142506241 |
| Molecular Formula | C29H34N8O3 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 2,4-diamino-6-methylpyrimidine-5-carbonitrile;N-hydroxy-6-(4-oxo-3-phenyl-2-propylquinazolin-5-yl)hexanamide |
| SMILES | CCCc1nc2cccc(CCCCCC(=O)NO)c2c(=O)n1-c1ccccc1.Cc1nc(N)nc(N)c1C#N |
| InChI | InChI=1S/C23H27N3O3.C6H7N5/c1-2-10-20-24-19-15-9-12-17(11-5-3-8-16-21(27)25-29)22(19)23(28)26(20)18-13-6-4-7-14-18;1-3-4(2-7)5(8)11-6(9)10-3/h4,6-7,9,12-15,29H,2-3,5,8,10-11,16H2,1H3,(H,25,27);1H3,(H4,8,9,10,11) |
| InChIKey | QOYYADAHUMWANA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 185.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|