C23H20N8O2 — CID 137368140
N-hydroxy-4-[2-[3-(7H-purin-6-ylamino)propyl]quinazolin-4-yl]benzamide (PubChem CID 137368140) has the molecular formula C23H20N8O2 and a molecular weight of 440.47 g/mol. Its IUPAC name is N-hydroxy-4-[2-[3-(7H-purin-6-ylamino)propyl]quinazolin-4-yl]benzamide.
| Compound Name | N-hydroxy-4-[2-[3-(7H-purin-6-ylamino)propyl]quinazolin-4-yl]benzamide |
|---|---|
| PubChem CID | 137368140 |
| Molecular Formula | C23H20N8O2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-hydroxy-4-[2-[3-(7H-purin-6-ylamino)propyl]quinazolin-4-yl]benzamide |
| SMILES | O=C(NO)c1ccc(-c2nc(CCCNc3ncnc4nc[nH]c34)nc3ccccc23)cc1 |
| InChI | InChI=1S/C23H20N8O2/c32-23(31-33)15-9-7-14(8-10-15)19-16-4-1-2-5-17(16)29-18(30-19)6-3-11-24-21-20-22(26-12-25-20)28-13-27-21/h1-2,4-5,7-10,12-13,33H,3,6,11H2,(H,31,32)(H2,24,25,26,27,28) |
| InChIKey | CVPBXMHYPJYYLM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 141.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|