C22H29N9O2 — CID 142506227
N-hydroxy-6-[(2-propylquinazolin-4-yl)amino]hexanamide;7H-purin-6-amine (PubChem CID 142506227) has the molecular formula C22H29N9O2 and a molecular weight of 451.54 g/mol. Its IUPAC name is N-hydroxy-6-[(2-propylquinazolin-4-yl)amino]hexanamide;7H-purin-6-amine.
| Compound Name | N-hydroxy-6-[(2-propylquinazolin-4-yl)amino]hexanamide;7H-purin-6-amine |
|---|---|
| PubChem CID | 142506227 |
| Molecular Formula | C22H29N9O2 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | N-hydroxy-6-[(2-propylquinazolin-4-yl)amino]hexanamide;7H-purin-6-amine |
| SMILES | CCCc1nc(NCCCCCC(=O)NO)c2ccccc2n1.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C17H24N4O2.C5H5N5/c1-2-8-15-19-14-10-6-5-9-13(14)17(20-15)18-12-7-3-4-11-16(22)21-23;6-4-3-5(9-1-7-3)10-2-8-4/h5-6,9-10,23H,2-4,7-8,11-12H2,1H3,(H,21,22)(H,18,19,20);1-2H,(H3,6,7,8,9,10) |
| InChIKey | NGVQIHNYUFLAER-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 167.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|