C22H24N6O2 — CID 58008982
8-methyl-2-(oxan-4-yl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one (PubChem CID 58008982) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 8-methyl-2-(oxan-4-yl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one.
| Compound Name | 8-methyl-2-(oxan-4-yl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 58008982 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 8-methyl-2-(oxan-4-yl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
| SMILES | Cc1cccc2cc(C(C)Nc3ncnc4nc[nH]c34)n(C3CCOCC3)c(=O)c12 |
| InChI | InChI=1S/C22H24N6O2/c1-13-4-3-5-15-10-17(28(22(29)18(13)15)16-6-8-30-9-7-16)14(2)27-21-19-20(24-11-23-19)25-12-26-21/h3-5,10-12,14,16H,6-9H2,1-2H3,(H2,23,24,25,26,27) |
| InChIKey | RVCWJSKUGLHUEL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |