C23H18N8O — CID 11517414
3-[5-methyl-4-oxo-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-3-yl]benzonitrile (PubChem CID 11517414) has the molecular formula C23H18N8O and a molecular weight of 422.45 g/mol. Its IUPAC name is 3-[5-methyl-4-oxo-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-3-yl]benzonitrile.
| Compound Name | 3-[5-methyl-4-oxo-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 11517414 |
| Molecular Formula | C23H18N8O |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3-[5-methyl-4-oxo-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-3-yl]benzonitrile |
| SMILES | Cc1cccc2nc(C(C)Nc3ncnc4nc[nH]c34)n(-c3cccc(C#N)c3)c(=O)c12 |
| InChI | InChI=1S/C23H18N8O/c1-13-5-3-8-17-18(13)23(32)31(16-7-4-6-15(9-16)10-24)22(30-17)14(2)29-21-19-20(26-11-25-19)27-12-28-21/h3-9,11-12,14H,1-2H3,(H2,25,26,27,28,29) |
| InChIKey | GBHQQXBDLYGRRO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |