C22H20N8O — CID 11611303
2-[1-[(2-amino-7H-purin-6-yl)amino]ethyl]-5-methyl-3-phenylquinazolin-4-one (PubChem CID 11611303) has the molecular formula C22H20N8O and a molecular weight of 412.46 g/mol. Its IUPAC name is 2-[1-[(2-amino-7H-purin-6-yl)amino]ethyl]-5-methyl-3-phenylquinazolin-4-one.
| Compound Name | 2-[1-[(2-amino-7H-purin-6-yl)amino]ethyl]-5-methyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 11611303 |
| Molecular Formula | C22H20N8O |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-[1-[(2-amino-7H-purin-6-yl)amino]ethyl]-5-methyl-3-phenylquinazolin-4-one |
| SMILES | Cc1cccc2nc(C(C)Nc3nc(N)nc4nc[nH]c34)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C22H20N8O/c1-12-7-6-10-15-16(12)21(31)30(14-8-4-3-5-9-14)20(27-15)13(2)26-19-17-18(25-11-24-17)28-22(23)29-19/h3-11,13H,1-2H3,(H4,23,24,25,26,28,29) |
| InChIKey | PDROOIFXUNZFRH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 127.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |