C32H31N9O3 — CID 11505258
benzyl N-[4-[(2-amino-7H-purin-6-yl)amino]-4-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)butyl]carbamate (PubChem CID 11505258) has the molecular formula C32H31N9O3 and a molecular weight of 589.66 g/mol. Its IUPAC name is benzyl N-[4-[(2-amino-7H-purin-6-yl)amino]-4-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)butyl]carbamate.
| Compound Name | benzyl N-[4-[(2-amino-7H-purin-6-yl)amino]-4-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)butyl]carbamate |
|---|---|
| PubChem CID | 11505258 |
| Molecular Formula | C32H31N9O3 |
| Molecular Weight | 589.66 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | benzyl N-[4-[(2-amino-7H-purin-6-yl)amino]-4-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)butyl]carbamate |
| SMILES | Cc1cccc2nc(C(CCCNC(=O)OCc3ccccc3)Nc3nc(N)nc4nc[nH]c34)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C32H31N9O3/c1-20-10-8-15-23-25(20)30(42)41(22-13-6-3-7-14-22)29(38-23)24(37-28-26-27(36-19-35-26)39-31(33)40-28)16-9-17-34-32(43)44-18-21-11-4-2-5-12-21/h2-8,10-15,19,24H,9,16-18H2,1H3,(H,34,43)(H4,33,35,36,37,39,40) |
| InChIKey | PTJCGYBEBCIBCO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 165.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|