C23H19F3N8O — CID 73332637
3-anilino-2-[1-(7H-purin-6-ylamino)propyl]-5-(trifluoromethyl)quinazolin-4-one (PubChem CID 73332637) has the molecular formula C23H19F3N8O and a molecular weight of 480.45 g/mol. Its IUPAC name is 3-anilino-2-[1-(7H-purin-6-ylamino)propyl]-5-(trifluoromethyl)quinazolin-4-one.
| Compound Name | 3-anilino-2-[1-(7H-purin-6-ylamino)propyl]-5-(trifluoromethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 73332637 |
| Molecular Formula | C23H19F3N8O |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 3-anilino-2-[1-(7H-purin-6-ylamino)propyl]-5-(trifluoromethyl)quinazolin-4-one |
| SMILES | CCC(Nc1ncnc2nc[nH]c12)c1nc2cccc(C(F)(F)F)c2c(=O)n1Nc1ccccc1 |
| InChI | InChI=1S/C23H19F3N8O/c1-2-15(31-20-18-19(28-11-27-18)29-12-30-20)21-32-16-10-6-9-14(23(24,25)26)17(16)22(35)34(21)33-13-7-4-3-5-8-13/h3-12,15,33H,2H2,1H3,(H2,27,28,29,30,31) |
| InChIKey | RBWDGXLWBXSAIQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |