C24H23F3N8O — CID 90063399
3-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]-2-[1-(7H-purin-6-ylamino)propyl]-5-(trifluoromethyl)quinazolin-4-one (PubChem CID 90063399) has the molecular formula C24H23F3N8O and a molecular weight of 496.50 g/mol. Its IUPAC name is 3-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]-2-[1-(7H-purin-6-ylamino)propyl]-5-(trifluoromethyl)quinazolin-4-one.
| Compound Name | 3-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]-2-[1-(7H-purin-6-ylamino)propyl]-5-(trifluoromethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 90063399 |
| Molecular Formula | C24H23F3N8O |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 3-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]-2-[1-(7H-purin-6-ylamino)propyl]-5-(trifluoromethyl)quinazolin-4-one |
| SMILES | C=C/C=C(\C=C/C)Nn1c(C(CC)Nc2ncnc3nc[nH]c23)nc2cccc(C(F)(F)F)c2c1=O |
| InChI | InChI=1S/C24H23F3N8O/c1-4-8-14(9-5-2)34-35-22(16(6-3)32-21-19-20(29-12-28-19)30-13-31-21)33-17-11-7-10-15(24(25,26)27)18(17)23(35)36/h4-5,7-13,16,34H,1,6H2,2-3H3,(H2,28,29,30,31,32)/b9-5-,14-8+ |
| InChIKey | YQPKNYKGTZBOHJ-OQGBNFCBSA-N |
| XLogP | 4.83 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|