C23H19ClN6 — CID 121486483
N-[(1S)-1-[5-chloro-3-(3-methylphenyl)quinolin-2-yl]ethyl]-7H-purin-6-amine (PubChem CID 121486483) has the molecular formula C23H19ClN6 and a molecular weight of 414.90 g/mol. Its IUPAC name is N-[(1S)-1-[5-chloro-3-(3-methylphenyl)quinolin-2-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[(1S)-1-[5-chloro-3-(3-methylphenyl)quinolin-2-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 121486483 |
| Molecular Formula | C23H19ClN6 |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-[(1S)-1-[5-chloro-3-(3-methylphenyl)quinolin-2-yl]ethyl]-7H-purin-6-amine |
| SMILES | Cc1cccc(-c2cc3c(Cl)cccc3nc2[C@H](C)Nc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C23H19ClN6/c1-13-5-3-6-15(9-13)16-10-17-18(24)7-4-8-19(17)30-20(16)14(2)29-23-21-22(26-11-25-21)27-12-28-23/h3-12,14H,1-2H3,(H2,25,26,27,28,29)/t14-/m0/s1 |
| InChIKey | HIDNUIWCOVNRRZ-AWEZNQCLSA-N |
| XLogP | 5.70 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |