C23H24ClN5O2 — CID 88536317
N-[1-[5-chloro-3-(3-ethoxyphenyl)-2-methoxy-4-methylphenyl]ethyl]-7H-purin-6-amine (PubChem CID 88536317) has the molecular formula C23H24ClN5O2 and a molecular weight of 437.93 g/mol. Its IUPAC name is N-[1-[5-chloro-3-(3-ethoxyphenyl)-2-methoxy-4-methylphenyl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[5-chloro-3-(3-ethoxyphenyl)-2-methoxy-4-methylphenyl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 88536317 |
| Molecular Formula | C23H24ClN5O2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[1-[5-chloro-3-(3-ethoxyphenyl)-2-methoxy-4-methylphenyl]ethyl]-7H-purin-6-amine |
| SMILES | CCOc1cccc(-c2c(C)c(Cl)cc(C(C)Nc3ncnc4nc[nH]c34)c2OC)c1 |
| InChI | InChI=1S/C23H24ClN5O2/c1-5-31-16-8-6-7-15(9-16)19-13(2)18(24)10-17(21(19)30-4)14(3)29-23-20-22(26-11-25-20)27-12-28-23/h6-12,14H,5H2,1-4H3,(H2,25,26,27,28,29) |
| InChIKey | YASYYLGSCDHKHV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |