C19H19FN8O — CID 88536221
N-[1-[3-(2-aminopyrimidin-5-yl)-5-fluoro-2-methoxy-4-methylphenyl]ethyl]-7H-purin-6-amine (PubChem CID 88536221) has the molecular formula C19H19FN8O and a molecular weight of 394.41 g/mol. Its IUPAC name is N-[1-[3-(2-aminopyrimidin-5-yl)-5-fluoro-2-methoxy-4-methylphenyl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[3-(2-aminopyrimidin-5-yl)-5-fluoro-2-methoxy-4-methylphenyl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 88536221 |
| Molecular Formula | C19H19FN8O |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[1-[3-(2-aminopyrimidin-5-yl)-5-fluoro-2-methoxy-4-methylphenyl]ethyl]-7H-purin-6-amine |
| SMILES | COc1c(C(C)Nc2ncnc3nc[nH]c23)cc(F)c(C)c1-c1cnc(N)nc1 |
| InChI | InChI=1S/C19H19FN8O/c1-9-13(20)4-12(16(29-3)14(9)11-5-22-19(21)23-6-11)10(2)28-18-15-17(25-7-24-15)26-8-27-18/h4-8,10H,1-3H3,(H2,21,22,23)(H2,24,25,26,27,28) |
| InChIKey | KJZGOSJCBJEGCO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 127.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |