C22H20ClFN6O2 — CID 57380535
5-[5-chloro-2-methoxy-6-methyl-3-[1-(7H-purin-6-ylamino)ethyl]phenyl]-2-fluorobenzamide (PubChem CID 57380535) has the molecular formula C22H20ClFN6O2 and a molecular weight of 454.89 g/mol. Its IUPAC name is 5-[5-chloro-2-methoxy-6-methyl-3-[1-(7H-purin-6-ylamino)ethyl]phenyl]-2-fluorobenzamide.
| Compound Name | 5-[5-chloro-2-methoxy-6-methyl-3-[1-(7H-purin-6-ylamino)ethyl]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 57380535 |
| Molecular Formula | C22H20ClFN6O2 |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 5-[5-chloro-2-methoxy-6-methyl-3-[1-(7H-purin-6-ylamino)ethyl]phenyl]-2-fluorobenzamide |
| SMILES | COc1c(C(C)Nc2ncnc3nc[nH]c23)cc(Cl)c(C)c1-c1ccc(F)c(C(N)=O)c1 |
| InChI | InChI=1S/C22H20ClFN6O2/c1-10-15(23)7-13(11(2)30-22-18-21(27-8-26-18)28-9-29-22)19(32-3)17(10)12-4-5-16(24)14(6-12)20(25)31/h4-9,11H,1-3H3,(H2,25,31)(H2,26,27,28,29,30) |
| InChIKey | SJMXRCKZFDKQAI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |