C28H25ClN6O — CID 88536364
N-[4-[3-chloro-2-methyl-6-phenyl-5-[1-(7H-purin-6-ylamino)ethyl]phenyl]phenyl]acetamide (PubChem CID 88536364) has the molecular formula C28H25ClN6O and a molecular weight of 497.00 g/mol. Its IUPAC name is N-[4-[3-chloro-2-methyl-6-phenyl-5-[1-(7H-purin-6-ylamino)ethyl]phenyl]phenyl]acetamide.
| Compound Name | N-[4-[3-chloro-2-methyl-6-phenyl-5-[1-(7H-purin-6-ylamino)ethyl]phenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 88536364 |
| Molecular Formula | C28H25ClN6O |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | N-[4-[3-chloro-2-methyl-6-phenyl-5-[1-(7H-purin-6-ylamino)ethyl]phenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2c(C)c(Cl)cc(C(C)Nc3ncnc4nc[nH]c34)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25ClN6O/c1-16-23(29)13-22(17(2)34-28-26-27(31-14-30-26)32-15-33-28)25(19-7-5-4-6-8-19)24(16)20-9-11-21(12-10-20)35-18(3)36/h4-15,17H,1-3H3,(H,35,36)(H2,30,31,32,33,34) |
| InChIKey | IADNDZGDLGWCHO-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |