C24H15ClF4N6 — CID 67969248
N-[1-[5-chloro-2-(3,5-difluorophenyl)-3-(2,6-difluoro-4-pyridinyl)phenyl]ethyl]-7H-purin-6-amine (PubChem CID 67969248) has the molecular formula C24H15ClF4N6 and a molecular weight of 498.87 g/mol. Its IUPAC name is N-[1-[5-chloro-2-(3,5-difluorophenyl)-3-(2,6-difluoro-4-pyridinyl)phenyl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[5-chloro-2-(3,5-difluorophenyl)-3-(2,6-difluoro-4-pyridinyl)phenyl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 67969248 |
| Molecular Formula | C24H15ClF4N6 |
| Molecular Weight | 498.87 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | N-[1-[5-chloro-2-(3,5-difluorophenyl)-3-(2,6-difluoro-4-pyridinyl)phenyl]ethyl]-7H-purin-6-amine |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc(Cl)cc(-c2cc(F)nc(F)c2)c1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C24H15ClF4N6/c1-11(34-24-22-23(31-9-30-22)32-10-33-24)17-6-14(25)7-18(12-4-19(28)35-20(29)5-12)21(17)13-2-15(26)8-16(27)3-13/h2-11H,1H3,(H2,30,31,32,33,34) |
| InChIKey | IDQLJNLGAVZFIZ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.87 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|