C20H18ClFN6O — CID 88536261
N-[1-[5-chloro-3-(2-fluoro-4-pyridinyl)-2-methoxy-4-methylphenyl]ethyl]-7H-purin-6-amine (PubChem CID 88536261) has the molecular formula C20H18ClFN6O and a molecular weight of 412.86 g/mol. Its IUPAC name is N-[1-[5-chloro-3-(2-fluoro-4-pyridinyl)-2-methoxy-4-methylphenyl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[5-chloro-3-(2-fluoro-4-pyridinyl)-2-methoxy-4-methylphenyl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 88536261 |
| Molecular Formula | C20H18ClFN6O |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-[1-[5-chloro-3-(2-fluoro-4-pyridinyl)-2-methoxy-4-methylphenyl]ethyl]-7H-purin-6-amine |
| SMILES | COc1c(C(C)Nc2ncnc3nc[nH]c23)cc(Cl)c(C)c1-c1ccnc(F)c1 |
| InChI | InChI=1S/C20H18ClFN6O/c1-10-14(21)7-13(18(29-3)16(10)12-4-5-23-15(22)6-12)11(2)28-20-17-19(25-8-24-17)26-9-27-20/h4-9,11H,1-3H3,(H2,24,25,26,27,28) |
| InChIKey | KAPQJHFHAGVTJW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|