C21H24FN7O — CID 46870413
7-fluoro-N-(3-methoxypropyl)-8-methyl-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]quinolin-2-amine (PubChem CID 46870413) has the molecular formula C21H24FN7O and a molecular weight of 409.47 g/mol. Its IUPAC name is 7-fluoro-N-(3-methoxypropyl)-8-methyl-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]quinolin-2-amine.
| Compound Name | 7-fluoro-N-(3-methoxypropyl)-8-methyl-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]quinolin-2-amine |
|---|---|
| PubChem CID | 46870413 |
| Molecular Formula | C21H24FN7O |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 7-fluoro-N-(3-methoxypropyl)-8-methyl-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]quinolin-2-amine |
| SMILES | COCCCNc1nc2c(C)c(F)ccc2cc1[C@H](C)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C21H24FN7O/c1-12-16(22)6-5-14-9-15(19(29-17(12)14)23-7-4-8-30-3)13(2)28-21-18-20(25-10-24-18)26-11-27-21/h5-6,9-11,13H,4,7-8H2,1-3H3,(H,23,29)(H2,24,25,26,27,28)/t13-/m0/s1 |
| InChIKey | AAPYNGVMWPZAEY-ZDUSSCGKSA-N |
| XLogP | 3.97 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|