C19H19ClN8 — CID 71142696
N-[(1S)-1-(5-chloro-4-pyrrolidin-1-ylquinazolin-2-yl)ethyl]-7H-purin-6-amine (PubChem CID 71142696) has the molecular formula C19H19ClN8 and a molecular weight of 394.87 g/mol. Its IUPAC name is N-[(1S)-1-(5-chloro-4-pyrrolidin-1-ylquinazolin-2-yl)ethyl]-7H-purin-6-amine.
| Compound Name | N-[(1S)-1-(5-chloro-4-pyrrolidin-1-ylquinazolin-2-yl)ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 71142696 |
| Molecular Formula | C19H19ClN8 |
| Molecular Weight | 394.87 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[(1S)-1-(5-chloro-4-pyrrolidin-1-ylquinazolin-2-yl)ethyl]-7H-purin-6-amine |
| SMILES | C[C@H](Nc1ncnc2nc[nH]c12)c1nc(N2CCCC2)c2c(Cl)cccc2n1 |
| InChI | InChI=1S/C19H19ClN8/c1-11(25-18-15-17(22-9-21-15)23-10-24-18)16-26-13-6-4-5-12(20)14(13)19(27-16)28-7-2-3-8-28/h4-6,9-11H,2-3,7-8H2,1H3,(H2,21,22,23,24,25)/t11-/m0/s1 |
| InChIKey | AKXWROLUSQNRSX-NSHDSACASA-N |
| XLogP | 3.72 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.87 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |