C20H20ClN7O — CID 78032857
N-[1-(8-chloro-1-morpholin-4-ylisoquinolin-3-yl)ethyl]-7H-purin-6-amine (PubChem CID 78032857) has the molecular formula C20H20ClN7O and a molecular weight of 409.88 g/mol. Its IUPAC name is N-[1-(8-chloro-1-morpholin-4-ylisoquinolin-3-yl)ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-(8-chloro-1-morpholin-4-ylisoquinolin-3-yl)ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 78032857 |
| Molecular Formula | C20H20ClN7O |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[1-(8-chloro-1-morpholin-4-ylisoquinolin-3-yl)ethyl]-7H-purin-6-amine |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc2cccc(Cl)c2c(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H20ClN7O/c1-12(26-19-17-18(23-10-22-17)24-11-25-19)15-9-13-3-2-4-14(21)16(13)20(27-15)28-5-7-29-8-6-28/h2-4,9-12H,5-8H2,1H3,(H2,22,23,24,25,26) |
| InChIKey | FAQJXZPLTJIKDL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |