C19H18ClN7 — CID 66821892
8-chloro-N-cyclopropyl-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]quinolin-2-amine (PubChem CID 66821892) has the molecular formula C19H18ClN7 and a molecular weight of 379.86 g/mol. Its IUPAC name is 8-chloro-N-cyclopropyl-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]quinolin-2-amine.
| Compound Name | 8-chloro-N-cyclopropyl-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]quinolin-2-amine |
|---|---|
| PubChem CID | 66821892 |
| Molecular Formula | C19H18ClN7 |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 8-chloro-N-cyclopropyl-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]quinolin-2-amine |
| SMILES | C[C@H](Nc1ncnc2nc[nH]c12)c1cc2cccc(Cl)c2nc1NC1CC1 |
| InChI | InChI=1S/C19H18ClN7/c1-10(25-19-16-18(22-8-21-16)23-9-24-19)13-7-11-3-2-4-14(20)15(11)27-17(13)26-12-5-6-12/h2-4,7-10,12H,5-6H2,1H3,(H,26,27)(H2,21,22,23,24,25)/t10-/m0/s1 |
| InChIKey | TYHKQBYBJGKPDS-JTQLQIEISA-N |
| XLogP | 4.30 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |