C20H20ClN7O2 — CID 68751254
N-[2-[8-chloro-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-yl]oxyethyl]acetamide (PubChem CID 68751254) has the molecular formula C20H20ClN7O2 and a molecular weight of 425.88 g/mol. Its IUPAC name is N-[2-[8-chloro-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-yl]oxyethyl]acetamide.
| Compound Name | N-[2-[8-chloro-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-yl]oxyethyl]acetamide |
|---|---|
| PubChem CID | 68751254 |
| Molecular Formula | C20H20ClN7O2 |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[2-[8-chloro-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-yl]oxyethyl]acetamide |
| SMILES | CC(=O)NCCOc1nc(C(C)Nc2ncnc3nc[nH]c23)cc2cccc(Cl)c12 |
| InChI | InChI=1S/C20H20ClN7O2/c1-11(27-19-17-18(24-9-23-17)25-10-26-19)15-8-13-4-3-5-14(21)16(13)20(28-15)30-7-6-22-12(2)29/h3-5,8-11H,6-7H2,1-2H3,(H,22,29)(H2,23,24,25,26,27) |
| InChIKey | BJQIAMXGZYBGNF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|