C22H18FN7 — CID 71550309
N-[1-[3-(4-fluorophenyl)-5-methylquinoxalin-2-yl]ethyl]-7H-purin-6-amine (PubChem CID 71550309) has the molecular formula C22H18FN7 and a molecular weight of 399.43 g/mol. Its IUPAC name is N-[1-[3-(4-fluorophenyl)-5-methylquinoxalin-2-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[3-(4-fluorophenyl)-5-methylquinoxalin-2-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 71550309 |
| Molecular Formula | C22H18FN7 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[1-[3-(4-fluorophenyl)-5-methylquinoxalin-2-yl]ethyl]-7H-purin-6-amine |
| SMILES | Cc1cccc2nc(C(C)Nc3ncnc4nc[nH]c34)c(-c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C22H18FN7/c1-12-4-3-5-16-17(12)30-19(14-6-8-15(23)9-7-14)18(29-16)13(2)28-22-20-21(25-10-24-20)26-11-27-22/h3-11,13H,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | FSIORUJUSKOXLS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |