C20H18N7+ — CID 123434309
N-[1-(3-phenyl-1H-benzimidazol-3-ium-2-yl)ethyl]-7H-purin-6-amine (PubChem CID 123434309) has the molecular formula C20H18N7+ and a molecular weight of 356.41 g/mol. Its IUPAC name is N-[1-(3-phenyl-1H-benzimidazol-3-ium-2-yl)ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-(3-phenyl-1H-benzimidazol-3-ium-2-yl)ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 123434309 |
| Molecular Formula | C20H18N7+ |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-[1-(3-phenyl-1H-benzimidazol-3-ium-2-yl)ethyl]-7H-purin-6-amine |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1[nH]c2ccccc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C20H17N7/c1-13(25-19-17-18(22-11-21-17)23-12-24-19)20-26-15-9-5-6-10-16(15)27(20)14-7-3-2-4-8-14/h2-13H,1H3,(H2,21,22,23,24,25)/p+1 |
| InChIKey | LQYUSRKFUUBCOO-UHFFFAOYSA-O |
| XLogP | 3.28 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|