C15H11F2N7O — CID 136612419
5,7-difluoro-2-[1-(7H-purin-6-ylamino)ethyl]-3H-quinazolin-4-one (PubChem CID 136612419) has the molecular formula C15H11F2N7O and a molecular weight of 343.30 g/mol. Its IUPAC name is 5,7-difluoro-2-[1-(7H-purin-6-ylamino)ethyl]-3H-quinazolin-4-one.
| Compound Name | 5,7-difluoro-2-[1-(7H-purin-6-ylamino)ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136612419 |
| Molecular Formula | C15H11F2N7O |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 5,7-difluoro-2-[1-(7H-purin-6-ylamino)ethyl]-3H-quinazolin-4-one |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1nc2cc(F)cc(F)c2c(=O)[nH]1 |
| InChI | InChI=1S/C15H11F2N7O/c1-6(22-14-11-13(19-4-18-11)20-5-21-14)12-23-9-3-7(16)2-8(17)10(9)15(25)24-12/h2-6H,1H3,(H,23,24,25)(H2,18,19,20,21,22) |
| InChIKey | ZRRQHALFGFCOSU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |