C7H10F2N4O2 — CID 82009941
[6-(2,2-difluoroethoxy)-5-methoxypyrimidin-4-yl]hydrazine (PubChem CID 82009941) has the molecular formula C7H10F2N4O2 and a molecular weight of 220.18 g/mol. Its IUPAC name is [6-(2,2-difluoroethoxy)-5-methoxypyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2,2-difluoroethoxy)-5-methoxypyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 82009941 |
| Molecular Formula | C7H10F2N4O2 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | [6-(2,2-difluoroethoxy)-5-methoxypyrimidin-4-yl]hydrazine |
| SMILES | COc1c(NN)ncnc1OCC(F)F |
| InChI | InChI=1S/C7H10F2N4O2/c1-14-5-6(13-10)11-3-12-7(5)15-2-4(8)9/h3-4H,2,10H2,1H3,(H,11,12,13) |
| InChIKey | AKXCYQLIYIRIMT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|