C12H13FN4O2 — CID 102989666
[6-(5-fluoro-2-methylphenoxy)-5-methoxypyrimidin-4-yl]hydrazine (PubChem CID 102989666) has the molecular formula C12H13FN4O2 and a molecular weight of 264.26 g/mol. Its IUPAC name is [6-(5-fluoro-2-methylphenoxy)-5-methoxypyrimidin-4-yl]hydrazine.
| Compound Name | [6-(5-fluoro-2-methylphenoxy)-5-methoxypyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 102989666 |
| Molecular Formula | C12H13FN4O2 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | [6-(5-fluoro-2-methylphenoxy)-5-methoxypyrimidin-4-yl]hydrazine |
| SMILES | COc1c(NN)ncnc1Oc1cc(F)ccc1C |
| InChI | InChI=1S/C12H13FN4O2/c1-7-3-4-8(13)5-9(7)19-12-10(18-2)11(17-14)15-6-16-12/h3-6H,14H2,1-2H3,(H,15,16,17) |
| InChIKey | KCBBSSCBJKICIU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|