C12H14N4O2 — CID 80916535
[6-(2-methoxyphenoxy)-5-methylpyrimidin-4-yl]hydrazine (PubChem CID 80916535) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is [6-(2-methoxyphenoxy)-5-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2-methoxyphenoxy)-5-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80916535 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | [6-(2-methoxyphenoxy)-5-methylpyrimidin-4-yl]hydrazine |
| SMILES | COc1ccccc1Oc1ncnc(NN)c1C |
| InChI | InChI=1S/C12H14N4O2/c1-8-11(16-13)14-7-15-12(8)18-10-6-4-3-5-9(10)17-2/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | ORRYTBJTQMTTOI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|