C13H16N4O2 — CID 80930752
[6-(3-ethoxyphenoxy)-5-methylpyrimidin-4-yl]hydrazine (PubChem CID 80930752) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is [6-(3-ethoxyphenoxy)-5-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(3-ethoxyphenoxy)-5-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80930752 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | [6-(3-ethoxyphenoxy)-5-methylpyrimidin-4-yl]hydrazine |
| SMILES | CCOc1cccc(Oc2ncnc(NN)c2C)c1 |
| InChI | InChI=1S/C13H16N4O2/c1-3-18-10-5-4-6-11(7-10)19-13-9(2)12(17-14)15-8-16-13/h4-8H,3,14H2,1-2H3,(H,15,16,17) |
| InChIKey | VUFTZGUPGWRFOY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|