C12H13BrN4O2 — CID 104708877
[6-(2-bromo-4-methoxyphenoxy)-5-methylpyrimidin-4-yl]hydrazine (PubChem CID 104708877) has the molecular formula C12H13BrN4O2 and a molecular weight of 325.17 g/mol. Its IUPAC name is [6-(2-bromo-4-methoxyphenoxy)-5-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2-bromo-4-methoxyphenoxy)-5-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 104708877 |
| Molecular Formula | C12H13BrN4O2 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | [6-(2-bromo-4-methoxyphenoxy)-5-methylpyrimidin-4-yl]hydrazine |
| SMILES | COc1ccc(Oc2ncnc(NN)c2C)c(Br)c1 |
| InChI | InChI=1S/C12H13BrN4O2/c1-7-11(17-14)15-6-16-12(7)19-10-4-3-8(18-2)5-9(10)13/h3-6H,14H2,1-2H3,(H,15,16,17) |
| InChIKey | NDVKYBQLSCTJQG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|