C9H16N4O2 — CID 80925441
[6-(1-methoxypropan-2-yloxy)-5-methylpyrimidin-4-yl]hydrazine (PubChem CID 80925441) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is [6-(1-methoxypropan-2-yloxy)-5-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(1-methoxypropan-2-yloxy)-5-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80925441 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | [6-(1-methoxypropan-2-yloxy)-5-methylpyrimidin-4-yl]hydrazine |
| SMILES | COCC(C)Oc1ncnc(NN)c1C |
| InChI | InChI=1S/C9H16N4O2/c1-6(4-14-3)15-9-7(2)8(13-10)11-5-12-9/h5-6H,4,10H2,1-3H3,(H,11,12,13) |
| InChIKey | BCQZSWYTNOYZNH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|