C12H20FN5O — CID 80819434
N-butan-2-yl-3-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]propanamide (PubChem CID 80819434) has the molecular formula C12H20FN5O and a molecular weight of 269.32 g/mol. Its IUPAC name is N-butan-2-yl-3-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]propanamide.
| Compound Name | N-butan-2-yl-3-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]propanamide |
|---|---|
| PubChem CID | 80819434 |
| Molecular Formula | C12H20FN5O |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | N-butan-2-yl-3-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]propanamide |
| SMILES | CCC(C)NC(=O)CCNc1nc(NC)ncc1F |
| InChI | InChI=1S/C12H20FN5O/c1-4-8(2)17-10(19)5-6-15-11-9(13)7-16-12(14-3)18-11/h7-8H,4-6H2,1-3H3,(H,17,19)(H2,14,15,16,18) |
| InChIKey | DGGUKHDNNLTPSW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |