C9H14FN3O — CID 103669518
4-[(5-fluoro-6-methylpyrimidin-4-yl)amino]butan-2-ol (PubChem CID 103669518) has the molecular formula C9H14FN3O and a molecular weight of 199.23 g/mol. Its IUPAC name is 4-[(5-fluoro-6-methylpyrimidin-4-yl)amino]butan-2-ol.
| Compound Name | 4-[(5-fluoro-6-methylpyrimidin-4-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 103669518 |
| Molecular Formula | C9H14FN3O |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-[(5-fluoro-6-methylpyrimidin-4-yl)amino]butan-2-ol |
| SMILES | Cc1ncnc(NCCC(C)O)c1F |
| InChI | InChI=1S/C9H14FN3O/c1-6(14)3-4-11-9-8(10)7(2)12-5-13-9/h5-6,14H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | HMJXTOWLJIYPIP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |