C12H20FN3S — CID 113413399
5-fluoro-6-methyl-N-(6-methylsulfanylhexyl)pyrimidin-4-amine (PubChem CID 113413399) has the molecular formula C12H20FN3S and a molecular weight of 257.38 g/mol. Its IUPAC name is 5-fluoro-6-methyl-N-(6-methylsulfanylhexyl)pyrimidin-4-amine.
| Compound Name | 5-fluoro-6-methyl-N-(6-methylsulfanylhexyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 113413399 |
| Molecular Formula | C12H20FN3S |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 5-fluoro-6-methyl-N-(6-methylsulfanylhexyl)pyrimidin-4-amine |
| SMILES | CSCCCCCCNc1ncnc(C)c1F |
| InChI | InChI=1S/C12H20FN3S/c1-10-11(13)12(16-9-15-10)14-7-5-3-4-6-8-17-2/h9H,3-8H2,1-2H3,(H,14,15,16) |
| InChIKey | NSOSJFLTWIHGRX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|