C12H21FN4S — CID 114126675
5-fluoro-2-N-methyl-4-N-(6-methylsulfanylhexyl)pyrimidine-2,4-diamine (PubChem CID 114126675) has the molecular formula C12H21FN4S and a molecular weight of 272.39 g/mol. Its IUPAC name is 5-fluoro-2-N-methyl-4-N-(6-methylsulfanylhexyl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-methyl-4-N-(6-methylsulfanylhexyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114126675 |
| Molecular Formula | C12H21FN4S |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 5-fluoro-2-N-methyl-4-N-(6-methylsulfanylhexyl)pyrimidine-2,4-diamine |
| SMILES | CNc1ncc(F)c(NCCCCCCSC)n1 |
| InChI | InChI=1S/C12H21FN4S/c1-14-12-16-9-10(13)11(17-12)15-7-5-3-4-6-8-18-2/h9H,3-8H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | HIWFORSNHPQMRW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|