C11H16ClFN2S — CID 104925521
5-chloro-3-fluoro-N-(5-methylsulfanylpentyl)pyridin-2-amine (PubChem CID 104925521) has the molecular formula C11H16ClFN2S and a molecular weight of 262.78 g/mol. Its IUPAC name is 5-chloro-3-fluoro-N-(5-methylsulfanylpentyl)pyridin-2-amine.
| Compound Name | 5-chloro-3-fluoro-N-(5-methylsulfanylpentyl)pyridin-2-amine |
|---|---|
| PubChem CID | 104925521 |
| Molecular Formula | C11H16ClFN2S |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 5-chloro-3-fluoro-N-(5-methylsulfanylpentyl)pyridin-2-amine |
| SMILES | CSCCCCCNc1ncc(Cl)cc1F |
| InChI | InChI=1S/C11H16ClFN2S/c1-16-6-4-2-3-5-14-11-10(13)7-9(12)8-15-11/h7-8H,2-6H2,1H3,(H,14,15) |
| InChIKey | IBIWBQYFTPRSHZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|