C8H10ClFN2S — CID 79728558
5-chloro-3-fluoro-N-(2-methylsulfanylethyl)pyridin-2-amine (PubChem CID 79728558) has the molecular formula C8H10ClFN2S and a molecular weight of 220.70 g/mol. Its IUPAC name is 5-chloro-3-fluoro-N-(2-methylsulfanylethyl)pyridin-2-amine.
| Compound Name | 5-chloro-3-fluoro-N-(2-methylsulfanylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 79728558 |
| Molecular Formula | C8H10ClFN2S |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 5-chloro-3-fluoro-N-(2-methylsulfanylethyl)pyridin-2-amine |
| SMILES | CSCCNc1ncc(Cl)cc1F |
| InChI | InChI=1S/C8H10ClFN2S/c1-13-3-2-11-8-7(10)4-6(9)5-12-8/h4-5H,2-3H2,1H3,(H,11,12) |
| InChIKey | MYNMTNBODZNWTG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|