C10H15FN4O — CID 106238678
5-[(5-fluoro-6-methylpyrimidin-4-yl)amino]pentanamide (PubChem CID 106238678) has the molecular formula C10H15FN4O and a molecular weight of 226.25 g/mol. Its IUPAC name is 5-[(5-fluoro-6-methylpyrimidin-4-yl)amino]pentanamide.
| Compound Name | 5-[(5-fluoro-6-methylpyrimidin-4-yl)amino]pentanamide |
|---|---|
| PubChem CID | 106238678 |
| Molecular Formula | C10H15FN4O |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 5-[(5-fluoro-6-methylpyrimidin-4-yl)amino]pentanamide |
| SMILES | Cc1ncnc(NCCCCC(N)=O)c1F |
| InChI | InChI=1S/C10H15FN4O/c1-7-9(11)10(15-6-14-7)13-5-3-2-4-8(12)16/h6H,2-5H2,1H3,(H2,12,16)(H,13,14,15) |
| InChIKey | AIFCKHDTQWUHAM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|