C28H46N4O2Si — CID 167609326
4-[7-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2-(propylamino)pyrrolo[2,3-d]pyrimidin-5-yl]cyclohexane-1-carbaldehyde (PubChem CID 167609326) has the molecular formula C28H46N4O2Si and a molecular weight of 498.79 g/mol. Its IUPAC name is 4-[7-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2-(propylamino)pyrrolo[2,3-d]pyrimidin-5-yl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[7-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2-(propylamino)pyrrolo[2,3-d]pyrimidin-5-yl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 167609326 |
| Molecular Formula | C28H46N4O2Si |
| Molecular Weight | 498.79 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | 4-[7-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2-(propylamino)pyrrolo[2,3-d]pyrimidin-5-yl]cyclohexane-1-carbaldehyde |
| SMILES | CCCNc1ncc2c(C3CCC(C=O)CC3)cn(C3CCC(O[Si](C)(C)C(C)(C)C)CC3)c2n1 |
| InChI | InChI=1S/C28H46N4O2Si/c1-7-16-29-27-30-17-24-25(21-10-8-20(19-33)9-11-21)18-32(26(24)31-27)22-12-14-23(15-13-22)34-35(5,6)28(2,3)4/h17-23H,7-16H2,1-6H3,(H,29,30,31) |
| InChIKey | XONRCTXHPMDXKZ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.79 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|