C18H29N3OSi — CID 90093274
tert-butyl-dimethyl-(4-pyrrolo[2,3-d]pyrimidin-7-ylcyclohexyl)oxysilane (PubChem CID 90093274) has the molecular formula C18H29N3OSi and a molecular weight of 331.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-(4-pyrrolo[2,3-d]pyrimidin-7-ylcyclohexyl)oxysilane.
| Compound Name | tert-butyl-dimethyl-(4-pyrrolo[2,3-d]pyrimidin-7-ylcyclohexyl)oxysilane |
|---|---|
| PubChem CID | 90093274 |
| Molecular Formula | C18H29N3OSi |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | tert-butyl-dimethyl-(4-pyrrolo[2,3-d]pyrimidin-7-ylcyclohexyl)oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(n2ccc3cncnc32)CC1 |
| InChI | InChI=1S/C18H29N3OSi/c1-18(2,3)23(4,5)22-16-8-6-15(7-9-16)21-11-10-14-12-19-13-20-17(14)21/h10-13,15-16H,6-9H2,1-5H3 |
| InChIKey | IKPAWMPQEWUZHS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|