About N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane
N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane (PubChem CID 162389083) has the molecular formula C14H22N4
and a molecular weight of 246.36 g/mol. Its IUPAC name is N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane.
Molecular Properties
| Compound Name | N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane |
| PubChem CID | 162389083 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane |
| SMILES | CC.CN(C)C1CC(n2ccc3cncnc32)C1 |
| InChI | InChI=1S/C12H16N4.C2H6/c1-15(2)10-5-11(6-10)16-4-3-9-7-13-8-14-12(9)16;1-2/h3-4,7-8,10-11H,5-6H2,1-2H3;1-2H3 |
| InChIKey | TVIXOIULAUTFHU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane?
The IUPAC name of N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane (CID 162389083) is N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane.
What is the SMILES notation for N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane?
The canonical SMILES for N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane is CC.CN(C)C1CC(n2ccc3cncnc32)C1.
What is the InChIKey of N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane?
The InChIKey is TVIXOIULAUTFHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4.C2H6/c1-15(2)10-5-11(6-10)16-4-3-9-7-13-8-14-12(9)16;1-2/h3-4,7-8,10-11H,5-6H2,1-2H3;1-2H3.
What are the key properties of N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane?
N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane has a molecular weight of 246.36 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-pyrrolo[2,3-d]pyrimidin-7-ylcyclobutan-1-amine;ethane is sourced from PubChem (CID 162389083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).