About ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine
ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine (PubChem CID 143744456) has the molecular formula C18H29N3
and a molecular weight of 287.45 g/mol. Its IUPAC name is ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 143744456 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine |
| SMILES | CC.CCC1CCCC(n2ccc3cncnc32)CCC1 |
| InChI | InChI=1S/C16H23N3.C2H6/c1-2-13-5-3-7-15(8-4-6-13)19-10-9-14-11-17-12-18-16(14)19;1-2/h9-13,15H,2-8H2,1H3;1-2H3 |
| InChIKey | CAPZOYIGKACUQB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine?
The IUPAC name of ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine (CID 143744456) is ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine is CC.CCC1CCCC(n2ccc3cncnc32)CCC1.
What is the InChIKey of ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine?
The InChIKey is CAPZOYIGKACUQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3.C2H6/c1-2-13-5-3-7-15(8-4-6-13)19-10-9-14-11-17-12-18-16(14)19;1-2/h9-13,15H,2-8H2,1H3;1-2H3.
What are the key properties of ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine?
ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine has a molecular weight of 287.45 g/mol, XLogP of 5.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 143744456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).