C18H29N3 — CID 143744456
ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine (PubChem CID 143744456) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine.
| Compound Name | ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 143744456 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | ethane;7-(5-ethylcyclooctyl)pyrrolo[2,3-d]pyrimidine |
| SMILES | CC.CCC1CCCC(n2ccc3cncnc32)CCC1 |
| InChI | InChI=1S/C16H23N3.C2H6/c1-2-13-5-3-7-15(8-4-6-13)19-10-9-14-11-17-12-18-16(14)19;1-2/h9-13,15H,2-8H2,1H3;1-2H3 |
| InChIKey | CAPZOYIGKACUQB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |