C23H31N5 — CID 143590412
1-N-(7-cyclopentylpyrrolo[2,3-d]pyrimidin-2-yl)-4-N,4-N-dipropylbenzene-1,4-diamine (PubChem CID 143590412) has the molecular formula C23H31N5 and a molecular weight of 377.54 g/mol. Its IUPAC name is 1-N-(7-cyclopentylpyrrolo[2,3-d]pyrimidin-2-yl)-4-N,4-N-dipropylbenzene-1,4-diamine.
| Compound Name | 1-N-(7-cyclopentylpyrrolo[2,3-d]pyrimidin-2-yl)-4-N,4-N-dipropylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 143590412 |
| Molecular Formula | C23H31N5 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 1-N-(7-cyclopentylpyrrolo[2,3-d]pyrimidin-2-yl)-4-N,4-N-dipropylbenzene-1,4-diamine |
| SMILES | CCCN(CCC)c1ccc(Nc2ncc3ccn(C4CCCC4)c3n2)cc1 |
| InChI | InChI=1S/C23H31N5/c1-3-14-27(15-4-2)20-11-9-19(10-12-20)25-23-24-17-18-13-16-28(22(18)26-23)21-7-5-6-8-21/h9-13,16-17,21H,3-8,14-15H2,1-2H3,(H,24,25,26) |
| InChIKey | YAAASRRZUTXQRI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|