C19H23N5 — CID 58016039
1-N-(7-cyclopentylpyrrolo[2,3-d]pyrimidin-2-yl)-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 58016039) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 1-N-(7-cyclopentylpyrrolo[2,3-d]pyrimidin-2-yl)-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-(7-cyclopentylpyrrolo[2,3-d]pyrimidin-2-yl)-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 58016039 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 1-N-(7-cyclopentylpyrrolo[2,3-d]pyrimidin-2-yl)-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(Nc2ncc3ccn(C4CCCC4)c3n2)cc1 |
| InChI | InChI=1S/C19H23N5/c1-23(2)16-9-7-15(8-10-16)21-19-20-13-14-11-12-24(18(14)22-19)17-5-3-4-6-17/h7-13,17H,3-6H2,1-2H3,(H,20,21,22) |
| InChIKey | NOBFXBZVOKYHTN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|