C12H13IN4 — CID 116648876
1-N-(5-iodopyrimidin-2-yl)-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 116648876) has the molecular formula C12H13IN4 and a molecular weight of 340.17 g/mol. Its IUPAC name is 1-N-(5-iodopyrimidin-2-yl)-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-(5-iodopyrimidin-2-yl)-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 116648876 |
| Molecular Formula | C12H13IN4 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 1-N-(5-iodopyrimidin-2-yl)-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(Nc2ncc(I)cn2)cc1 |
| InChI | InChI=1S/C12H13IN4/c1-17(2)11-5-3-10(4-6-11)16-12-14-7-9(13)8-15-12/h3-8H,1-2H3,(H,14,15,16) |
| InChIKey | ZMRRVWNEMJEEHA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|