C28H39FN6O — CID 142078208
1-cyclohexyl-3-[(3E)-4-[2-[4-(dipropylamino)anilino]-4-methylpyrimidin-5-yl]-3-fluorobuta-1,3-dien-2-yl]urea (PubChem CID 142078208) has the molecular formula C28H39FN6O and a molecular weight of 494.66 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(3E)-4-[2-[4-(dipropylamino)anilino]-4-methylpyrimidin-5-yl]-3-fluorobuta-1,3-dien-2-yl]urea.
| Compound Name | 1-cyclohexyl-3-[(3E)-4-[2-[4-(dipropylamino)anilino]-4-methylpyrimidin-5-yl]-3-fluorobuta-1,3-dien-2-yl]urea |
|---|---|
| PubChem CID | 142078208 |
| Molecular Formula | C28H39FN6O |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | 1-cyclohexyl-3-[(3E)-4-[2-[4-(dipropylamino)anilino]-4-methylpyrimidin-5-yl]-3-fluorobuta-1,3-dien-2-yl]urea |
| SMILES | C=C(NC(=O)NC1CCCCC1)/C(F)=C\c1cnc(Nc2ccc(N(CCC)CCC)cc2)nc1C |
| InChI | InChI=1S/C28H39FN6O/c1-5-16-35(17-6-2)25-14-12-24(13-15-25)33-27-30-19-22(20(3)31-27)18-26(29)21(4)32-28(36)34-23-10-8-7-9-11-23/h12-15,18-19,23H,4-11,16-17H2,1-3H3,(H,30,31,33)(H2,32,34,36)/b26-18+ |
| InChIKey | KLXBDLJNGDJJSV-NLRVBDNBSA-N |
| XLogP | 6.61 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|