C23H36N2O2Si — CID 140850623
[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)methanol (PubChem CID 140850623) has the molecular formula C23H36N2O2Si and a molecular weight of 400.64 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)methanol.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)methanol |
|---|---|
| PubChem CID | 140850623 |
| Molecular Formula | C23H36N2O2Si |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)methanol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(C(O)c2c(C3CC3)ccn3cncc23)CC1 |
| InChI | InChI=1S/C23H36N2O2Si/c1-23(2,3)28(4,5)27-18-10-8-17(9-11-18)22(26)21-19(16-6-7-16)12-13-25-15-24-14-20(21)25/h12-18,22,26H,6-11H2,1-5H3 |
| InChIKey | CXGHNSZCYNNTGW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|