C17H22N2O2 — CID 122605011
4-[(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-hydroxymethyl]cyclohexan-1-ol (PubChem CID 122605011) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 4-[(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-hydroxymethyl]cyclohexan-1-ol.
| Compound Name | 4-[(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-hydroxymethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 122605011 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 4-[(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-hydroxymethyl]cyclohexan-1-ol |
| SMILES | OC1CCC(C(O)c2c(C3CC3)ccn3cncc23)CC1 |
| InChI | InChI=1S/C17H22N2O2/c20-13-5-3-12(4-6-13)17(21)16-14(11-1-2-11)7-8-19-10-18-9-15(16)19/h7-13,17,20-21H,1-6H2 |
| InChIKey | LMAVPZOWPXVGIN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 57.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |