C20H32N6O2 — CID 123900835
methyl 3-[2-(butylamino)-4-[(4-hydroxycyclohexyl)amino]pyrimidin-5-yl]-N-methyl-3-(methylideneamino)prop-2-enimidate (PubChem CID 123900835) has the molecular formula C20H32N6O2 and a molecular weight of 388.52 g/mol. Its IUPAC name is methyl 3-[2-(butylamino)-4-[(4-hydroxycyclohexyl)amino]pyrimidin-5-yl]-N-methyl-3-(methylideneamino)prop-2-enimidate.
| Compound Name | methyl 3-[2-(butylamino)-4-[(4-hydroxycyclohexyl)amino]pyrimidin-5-yl]-N-methyl-3-(methylideneamino)prop-2-enimidate |
|---|---|
| PubChem CID | 123900835 |
| Molecular Formula | C20H32N6O2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | methyl 3-[2-(butylamino)-4-[(4-hydroxycyclohexyl)amino]pyrimidin-5-yl]-N-methyl-3-(methylideneamino)prop-2-enimidate |
| SMILES | C=NC(=C/C(=N/C)OC)c1cnc(NCCCC)nc1NC1CCC(O)CC1 |
| InChI | InChI=1S/C20H32N6O2/c1-5-6-11-23-20-24-13-16(17(21-2)12-18(22-3)28-4)19(26-20)25-14-7-9-15(27)10-8-14/h12-15,27H,2,5-11H2,1,3-4H3,(H2,23,24,25,26)/b17-12?,22-18- |
| InChIKey | NFESJXDKPHODKM-LYKREYAGSA-N |
| XLogP | 3.12 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|